EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C44H48O18 |
| Net Charge | 0 |
| Average Mass | 864.850 |
| Monoisotopic Mass | 864.28406 |
| SMILES | [H][C@]1(O[C@@H]2C(=O)/C(=C(/C)O)C(=O)[C@@]3(O)C(=O)c4c(O)c5c(c(C)c4C[C@@]23O)C(=O)C(OC)=CC5=O)CC[C@]([H])(O[C@H]2C[C@@](C)(O)[C@H](OC(=O)c3c(C)ccc(C)c3O)[C@H](C)O2)[C@@H](C)O1 |
| InChI | InChI=1S/C44H48O18/c1-16-9-10-17(2)33(47)28(16)41(53)62-39-21(6)59-27(15-42(39,7)54)60-24-11-12-26(58-20(24)5)61-40-36(50)30(19(4)45)37(51)44(56)38(52)31-22(14-43(40,44)55)18(3)29-32(35(31)49)23(46)13-25(57-8)34(29)48/h9-10,13,20-21,24,26-27,39-40,45,47,49,54-56H,11-12,14-15H2,1-8H3/b30-19+/t20-,21+,24+,26+,27+,39-,40-,42-,43-,44-/m1/s1 |
| InChIKey | OWRCRVABZYJUES-FLJLGRLJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (9531983) | Strain: MK277 AF1 |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| polyketomycin (CHEBI:66771) has functional parent 3,6-dimethylsalicylic acid (CHEBI:70733) |
| polyketomycin (CHEBI:66771) has role antibacterial agent (CHEBI:33282) |
| polyketomycin (CHEBI:66771) has role antineoplastic agent (CHEBI:35610) |
| polyketomycin (CHEBI:66771) has role metabolite (CHEBI:25212) |
| polyketomycin (CHEBI:66771) is a p-quinones (CHEBI:25830) |
| polyketomycin (CHEBI:66771) is a benzoate ester (CHEBI:36054) |
| polyketomycin (CHEBI:66771) is a carbohydrate-containing antibiotic (CHEBI:23007) |
| polyketomycin (CHEBI:66771) is a carbopolycyclic compound (CHEBI:35294) |
| polyketomycin (CHEBI:66771) is a enol (CHEBI:33823) |
| polyketomycin (CHEBI:66771) is a glycoside (CHEBI:24400) |
| polyketomycin (CHEBI:66771) is a phenols (CHEBI:33853) |
| polyketomycin (CHEBI:66771) is a pyrans (CHEBI:26407) |
| polyketomycin (CHEBI:66771) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| IUPAC Name |
|---|
| (2R,3S,6S)-2-methyl-6-{[(1S,3E,4aS,12aR)-4a,6,12a-trihydroxy-3-(1-hydroxyethylidene)-9-methoxy-11-methyl-2,4,5,7,10-pentaoxo-1,2,3,4,4a,5,7,10,12,12a-decahydrotetracen-1-yl]oxy}tetrahydro-2H-pyran-3-yl 2,6-dideoxy-4-O-(2-hydroxy-3,6-dimethylbenzoyl)-3-C-methyl-α-L-xylo-hexopyranoside |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8184047 | Reaxys |
| CAS:200625-47-4 | ChemIDplus |
| Citations |
|---|