EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C44H48O18 |
| Net Charge | 0 |
| Average Mass | 864.850 |
| Monoisotopic Mass | 864.28406 |
| SMILES | [H][C@]1(O[C@@H]2C(=O)/C(=C(/C)O)C(=O)[C@@]3(O)C(=O)c4c(O)c5c(c(C)c4C[C@@]23O)C(=O)C(OC)=CC5=O)CC[C@]([H])(O[C@H]2C[C@@](C)(O)[C@H](OC(=O)c3c(C)ccc(C)c3O)[C@H](C)O2)[C@@H](C)O1 |
| InChI | InChI=1S/C44H48O18/c1-16-9-10-17(2)33(47)28(16)41(53)62-39-21(6)59-27(15-42(39,7)54)60-24-11-12-26(58-20(24)5)61-40-36(50)30(19(4)45)37(51)44(56)38(52)31-22(14-43(40,44)55)18(3)29-32(35(31)49)23(46)13-25(57-8)34(29)48/h9-10,13,20-21,24,26-27,39-40,45,47,49,54-56H,11-12,14-15H2,1-8H3/b30-19+/t20-,21+,24+,26+,27+,39-,40-,42-,43-,44-/m1/s1 |
| InChIKey | OWRCRVABZYJUES-FLJLGRLJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (9531983) | Strain: MK277 AF1 |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| polyketomycin (CHEBI:66771) has functional parent 3,6-dimethylsalicylic acid (CHEBI:70733) |
| polyketomycin (CHEBI:66771) has role antibacterial agent (CHEBI:33282) |
| polyketomycin (CHEBI:66771) has role antineoplastic agent (CHEBI:35610) |
| polyketomycin (CHEBI:66771) has role metabolite (CHEBI:25212) |
| polyketomycin (CHEBI:66771) is a p-quinones (CHEBI:25830) |
| polyketomycin (CHEBI:66771) is a benzoate ester (CHEBI:36054) |
| polyketomycin (CHEBI:66771) is a carbohydrate-containing antibiotic (CHEBI:23007) |
| polyketomycin (CHEBI:66771) is a carbopolycyclic compound (CHEBI:35294) |
| polyketomycin (CHEBI:66771) is a enol (CHEBI:33823) |
| polyketomycin (CHEBI:66771) is a glycoside (CHEBI:24400) |
| polyketomycin (CHEBI:66771) is a phenols (CHEBI:33853) |
| polyketomycin (CHEBI:66771) is a pyrans (CHEBI:26407) |
| polyketomycin (CHEBI:66771) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| IUPAC Name |
|---|
| (2R,3S,6S)-2-methyl-6-{[(1S,3E,4aS,12aR)-4a,6,12a-trihydroxy-3-(1-hydroxyethylidene)-9-methoxy-11-methyl-2,4,5,7,10-pentaoxo-1,2,3,4,4a,5,7,10,12,12a-decahydrotetracen-1-yl]oxy}tetrahydro-2H-pyran-3-yl 2,6-dideoxy-4-O-(2-hydroxy-3,6-dimethylbenzoyl)-3-C-methyl-α-L-xylo-hexopyranoside |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8184047 | Reaxys |
| CAS:200625-47-4 | ChemIDplus |
| Citations |
|---|