EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H24O9S |
| Net Charge | 0 |
| Average Mass | 344.382 |
| Monoisotopic Mass | 344.11410 |
| SMILES | O=S1CC(O)C(O)C(O)CC(O)CC(O)C(O)C(O)C(O)C1 |
| InChI | InChI=1S/C12H24O9S/c13-5-1-6(14)10(18)8(16)3-22(21)4-9(17)12(20)11(19)7(15)2-5/h5-20H,1-4H2 |
| InChIKey | ZCFDZGVJJBUOOF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Salacia reticulata (IPNI:162694-1) | stem (BTO:0001300) | PubMed (18547114) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Polyhydroxylated cyclic sulfoxide (CHEBI:66770) has role metabolite (CHEBI:25212) |
| Polyhydroxylated cyclic sulfoxide (CHEBI:66770) is a sulfoxide (CHEBI:22063) |
| Synonym | Source |
|---|---|
| Thiacyclotridecane-3,4,5,6,8,10,11,12-octol 1-oxide | ChEBI |
| Citations |
|---|