EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H17ClO6 |
| Net Charge | 0 |
| Average Mass | 364.781 |
| Monoisotopic Mass | 364.07137 |
| SMILES | [H][C@@]12Cc3ccc(o3)Cc3c(Cl)c(O)cc(O)c3C(=O)O[C@H](C)C[C@@]1([H])O2 |
| InChI | InChI=1S/C18H17ClO6/c1-8-4-14-15(25-14)6-10-3-2-9(24-10)5-11-16(18(22)23-8)12(20)7-13(21)17(11)19/h2-3,7-8,14-15,20-21H,4-6H2,1H3/t8-,14-,15-/m1/s1 |
| InChIKey | CFVKDYMHTACQOE-KBOAJJQZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pochonia chlamydosporia (ncbitaxon:280754) | - | DOI (10.1016/j.tetlet.2008.10.099) | Strain: TF 0480 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pochonin G (CHEBI:66767) has role metabolite (CHEBI:25212) |
| Pochonin G (CHEBI:66767) is a macrolide (CHEBI:25106) |