EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H34N2O6 |
| Net Charge | 0 |
| Average Mass | 422.522 |
| Monoisotopic Mass | 422.24169 |
| SMILES | [H][C@@]1([C@H](CC(C)C)NC(=O)[C@@H](O)[C@@H](O)[C@@H](N)CC(C)C)Cc2cccc(O)c2C(=O)O1 |
| InChI | InChI=1S/C22H34N2O6/c1-11(2)8-14(23)19(26)20(27)21(28)24-15(9-12(3)4)17-10-13-6-5-7-16(25)18(13)22(29)30-17/h5-7,11-12,14-15,17,19-20,25-27H,8-10,23H2,1-4H3,(H,24,28)/t14-,15-,17-,19-,20-/m0/s1 |
| InChIKey | ZGMSHKBULLTJHQ-UHBFJLORSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bacillus sp. (ncbitaxon:1409) | - | PubMed (9099230) | Strain: PhM PHD 090 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PM-94128 (CHEBI:66766) has role antimicrobial agent (CHEBI:33281) |
| PM-94128 (CHEBI:66766) has role antineoplastic agent (CHEBI:35610) |
| PM-94128 (CHEBI:66766) has role bacterial metabolite (CHEBI:76969) |
| PM-94128 (CHEBI:66766) is a isocoumarins (CHEBI:38758) |
| PM-94128 (CHEBI:66766) is a monocarboxylic acid amide (CHEBI:29347) |
| PM-94128 (CHEBI:66766) is a phenols (CHEBI:33853) |
| PM-94128 (CHEBI:66766) is a primary amino compound (CHEBI:50994) |
| PM-94128 (CHEBI:66766) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (2S,3S,4S)-4-amino-2,3-dihydroxy-N-{(1S)-1-[(3S)-8-hydroxy-1-oxo-3,4-dihydro-1H-isochromen-3-yl]-3-methylbutyl}-6-methylheptanamide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9592808 | Reaxys |
| Citations |
|---|