EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14O6 |
| Net Charge | 0 |
| Average Mass | 290.271 |
| Monoisotopic Mass | 290.07904 |
| SMILES | Cc1cc(O)c2c(c1)C(=O)C1=C(C2=O)[C@@H](O)[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C15H14O6/c1-5-2-6-10(8(16)3-5)14(20)11-7(12(6)18)4-9(17)13(19)15(11)21/h2-3,9,13,15-17,19,21H,4H2,1H3/t9-,13-,15+/m0/s1 |
| InChIKey | YUSJPHSHLVVZRA-DYQSUWPFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pleospora (ncbitaxon:28557) | - | PubMed (18442914) | An endophytic fungus from Anthyllis vulneraria L.(Fabaceae) Strain: MF7028 |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pleosporone (CHEBI:66765) has role antibacterial agent (CHEBI:33282) |
| pleosporone (CHEBI:66765) has role antineoplastic agent (CHEBI:35610) |
| pleosporone (CHEBI:66765) has role metabolite (CHEBI:25212) |
| pleosporone (CHEBI:66765) is a p-quinones (CHEBI:25830) |
| pleosporone (CHEBI:66765) is a carbotricyclic compound (CHEBI:38032) |
| pleosporone (CHEBI:66765) is a phenols (CHEBI:33853) |
| pleosporone (CHEBI:66765) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (1R,2S,3S)-1,2,3,8-tetrahydroxy-6-methyl-1,2,3,4-tetrahydroanthracene-9,10-dione |
| Citations |
|---|