EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H40O7 |
| Net Charge | 0 |
| Average Mass | 536.665 |
| Monoisotopic Mass | 536.27740 |
| SMILES | [H][C@@]12CCc3cc(C(C)C)c(OC(=O)C=C(C)C)c(O)c3[C@@]1(C)CCC[C@]2(C)COC(=O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C32H40O7/c1-18(2)14-26(35)39-29-22(19(3)4)15-20-9-11-25-31(5,12-7-13-32(25,6)27(20)28(29)36)17-38-30(37)21-8-10-23(33)24(34)16-21/h8,10,14-16,19,25,33-34,36H,7,9,11-13,17H2,1-6H3/t25-,31+,32-/m0/s1 |
| InChIKey | QIRPXSKEFCGQDR-FXZLDBAYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Plectranthus nummularius (IPNI:454595-1) | leaf (BTO:0000713) | PubMed (11558608) | Fresh leaves |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Plectranthol B (CHEBI:66764) has role metabolite (CHEBI:25212) |
| Plectranthol B (CHEBI:66764) is a diterpenoid (CHEBI:23849) |
| Synonym | Source |
|---|---|
| 12-O-(3-methyl-2-butenoyl)-19-O-(3,4-dihydroxybenzoyl)-11-hydroxyabieta-8,11,13-triene | ChEBI |
| Citations |
|---|