EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H30O6 |
| Net Charge | 0 |
| Average Mass | 450.531 |
| Monoisotopic Mass | 450.20424 |
| SMILES | CC(C)c1cc2c(c(O)c1O)C1=CCC[C@](C)(COC(=O)c3ccc(O)c(O)c3)[C@@]1(C)C=C2 |
| InChI | InChI=1S/C27H30O6/c1-15(2)18-12-16-9-11-27(4)19(22(16)24(31)23(18)30)6-5-10-26(27,3)14-33-25(32)17-7-8-20(28)21(29)13-17/h6-9,11-13,15,28-31H,5,10,14H2,1-4H3/t26-,27+/m1/s1 |
| InChIKey | VIWAYXHMGDZRSR-SXOMAYOGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Plectranthus nummularius (IPNI:454595-1) | leaf (BTO:0000713) | PubMed (11558608) | Fresh leaves |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Plectranthol A (CHEBI:66763) has role metabolite (CHEBI:25212) |
| Plectranthol A (CHEBI:66763) is a diterpenoid (CHEBI:23849) |
| Synonyms | Source |
|---|---|
| [(1S,10aS)-5,6-Dihydroxy-7-isopropyl-1,10a-dimethyl-1,2,3,10a-tetrahydro-1-phenanthrenyl]methyl 3,4-dihydroxybenzoate | ChEBI |
| 19-O-(3,4-dihydroxybenzoyl)-11,12-dihydroxy-20(10->5)-abeo-abieta-1(10),6,8,11,13-tetraene | ChEBI |
| Citations |
|---|