EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H40O4 |
| Net Charge | 0 |
| Average Mass | 428.613 |
| Monoisotopic Mass | 428.29266 |
| SMILES | CC1=CC(=O)C=C(C/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC[C@@H](O)C(C)(C)O)C1=O |
| InChI | InChI=1S/C27H40O4/c1-19(10-8-12-21(3)14-16-25(29)27(5,6)31)9-7-11-20(2)13-15-23-18-24(28)17-22(4)26(23)30/h9,12-13,17-18,25,29,31H,7-8,10-11,14-16H2,1-6H3/b19-9+,20-13+,21-12+/t25-/m1/s1 |
| InChIKey | LJDGRLBUXSKFJE-RILXQCJSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sargassum micracanthum (ncbitaxon:127448) | - | PubMed (15684504) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Plastoquinone 2 (CHEBI:66760) has role metabolite (CHEBI:25212) |
| Plastoquinone 2 (CHEBI:66760) is a 1,4-benzoquinones (CHEBI:132124) |
| Plastoquinone 2 (CHEBI:66760) is a diterpenoid (CHEBI:23849) |
| Synonym | Source |
|---|---|
| 2-[(2E,6E,10E,14R)-14,15-dihydroxy-3,7,11,15-tetramethylhexadeca-2,6,10-trienyl]-6-methylcyclohexa-2,5-diene-1,4-dione | ChEBI |
| Citations |
|---|