EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H41N |
| Net Charge | 0 |
| Average Mass | 331.588 |
| Monoisotopic Mass | 331.32390 |
| SMILES | CCCCCCCCCCCCCCCN(C)Cc1ccccc1 |
| InChI | InChI=1S/C23H41N/c1-3-4-5-6-7-8-9-10-11-12-13-14-18-21-24(2)22-23-19-16-15-17-20-23/h15-17,19-20H,3-14,18,21-22H2,1-2H3 |
| InChIKey | YMMNFUJNCOWQRX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Piptoporus betulinus (ncbitaxon:40450) | - | PubMed (11099232) | Strain: Lu 9-1 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Piptamine(antibiotic) (CHEBI:66758) has role metabolite (CHEBI:25212) |
| Piptamine(antibiotic) (CHEBI:66758) is a aromatic amine (CHEBI:33860) |
| Synonym | Source |
|---|---|
| N-benzyl-N-methylpentadecan-1-amine | ChEBI |
| Citations |
|---|