EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H38N2O6 |
| Net Charge | 0 |
| Average Mass | 570.686 |
| Monoisotopic Mass | 570.27299 |
| SMILES | O=C(/C=C\[C@@H]1[C@@H](/C=C/c2ccc3c(c2)OCO3)[C@H](C(=O)N2CCCCC2)[C@H]1c1ccc2c(c1)OCO2)N1CCCCC1 |
| InChI | InChI=1S/C34H38N2O6/c37-31(35-15-3-1-4-16-35)14-11-25-26(10-7-23-8-12-27-29(19-23)41-21-39-27)33(34(38)36-17-5-2-6-18-36)32(25)24-9-13-28-30(20-24)42-22-40-28/h7-14,19-20,25-26,32-33H,1-6,15-18,21-22H2/b10-7+,14-11-/t25-,26-,32+,33+/m1/s1 |
| InChIKey | MWYIPUPDBMGRSR-KZRNGNIQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Piper nigrum (ncbitaxon:13216) | |||
| whole plant (BTO:0001461) | PubMed (16808005) | Methanol extract of the plant | |
| fruit (BTO:0000486) | DOI (10.1016/S0040-4039(01)00209-X) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pipercyclobutanamide A(rel) (CHEBI:66757) has role metabolite (CHEBI:25212) |
| Pipercyclobutanamide A(rel) (CHEBI:66757) is a benzodioxoles (CHEBI:38298) |
| Pipercyclobutanamide A(rel) (CHEBI:66757) is a cyclobutanes (CHEBI:156473) |
| Citations |
|---|