EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16O4 |
| Net Charge | 0 |
| Average Mass | 272.300 |
| Monoisotopic Mass | 272.10486 |
| SMILES | COc1cc(O)cc(/C=C/c2cccc(O)c2OC)c1 |
| InChI | InChI=1S/C16H16O4/c1-19-14-9-11(8-13(17)10-14)6-7-12-4-3-5-15(18)16(12)20-2/h3-10,17-18H,1-2H3/b7-6+ |
| InChIKey | NYSXLCHSDQNVBS-VOTSOKGWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pholidota yunnanensis (ncbitaxon:169181) | whole plant (BTO:0001461) | PubMed (16394543) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 1.14.13.39 (nitric oxide synthase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of nitric oxide synthase (EC 1.14.13.39). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phoyunbene C (CHEBI:66755) has role EC 1.14.13.39 (nitric oxide synthase) inhibitor (CHEBI:61908) |
| phoyunbene C (CHEBI:66755) has role metabolite (CHEBI:25212) |
| phoyunbene C (CHEBI:66755) is a methoxybenzenes (CHEBI:51683) |
| phoyunbene C (CHEBI:66755) is a polyphenol (CHEBI:26195) |
| phoyunbene C (CHEBI:66755) is a stilbenoid (CHEBI:26776) |
| IUPAC Name |
|---|
| 3-[(E)-2-(3-hydroxy-5-methoxyphenyl)ethenyl]-2-methoxyphenol |
| Synonym | Source |
|---|---|
| trans-3,3'-dihydroxy-2',5-dimethoxystilbene | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10267005 | Reaxys |
| Citations |
|---|