EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H37NO4 |
| Net Charge | 0 |
| Average Mass | 415.574 |
| Monoisotopic Mass | 415.27226 |
| SMILES | [H][C@]12[C@H](CC(C)C)NC(=O)[C@]13C(=O)/C=C/[C@@H](O)C[C@@H](CO)C/C(C)=C/[C@@]3([H])C=C(C)[C@H]2C |
| InChI | InChI=1S/C25H37NO4/c1-14(2)8-21-23-17(5)16(4)11-19-10-15(3)9-18(13-27)12-20(28)6-7-22(29)25(19,23)24(30)26-21/h6-7,10-11,14,17-21,23,27-28H,8-9,12-13H2,1-5H3,(H,26,30)/b7-6+,15-10+/t17-,18+,19+,20-,21+,23+,25-/m1/s1 |
| InChIKey | AQAFUDMWTUOKSI-USVVNQICSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phoma (ncbitaxon:37463) | - | PubMed (11671521) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phomacin C (CHEBI:66748) has role antimicrobial agent (CHEBI:33281) |
| phomacin C (CHEBI:66748) has role antineoplastic agent (CHEBI:35610) |
| phomacin C (CHEBI:66748) has role metabolite (CHEBI:25212) |
| phomacin C (CHEBI:66748) is a cytochalasin (CHEBI:23528) |
| phomacin C (CHEBI:66748) is a macrocycle (CHEBI:51026) |
| phomacin C (CHEBI:66748) is a organic heterotricyclic compound (CHEBI:26979) |
| IUPAC Name |
|---|
| (3S,3aR,4S,6aS,7E,10S,12S,13E,15aS)-12-hydroxy-10-(hydroxymethyl)-4,5,8-trimethyl-3-(2-methylpropyl)-3,3a,4,6a,9,10,11,12-octahydro-1H-cycloundeca[d]isoindole-1,15(2H)-dione |
| Citations |
|---|