EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H37NO5 |
| Net Charge | 0 |
| Average Mass | 431.573 |
| Monoisotopic Mass | 431.26717 |
| SMILES | [H][C@]12[C@H](CC(C)C)NC(=O)[C@]13OC(=O)/C=C\[C@@H](O)[C@@H](O)[C@@H](C)C/C(C)=C/[C@@]3([H])C=C(C)[C@H]2C |
| InChI | InChI=1S/C25H37NO5/c1-13(2)9-19-22-17(6)15(4)12-18-11-14(3)10-16(5)23(29)20(27)7-8-21(28)31-25(18,22)24(30)26-19/h7-8,11-13,16-20,22-23,27,29H,9-10H2,1-6H3,(H,26,30)/b8-7-,14-11+/t16-,17+,18-,19-,20+,22-,23-,25+/m0/s1 |
| InChIKey | CTCWWHNYPVOMQP-WXZOGCPCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phoma (ncbitaxon:37463) | - | PubMed (11671521) |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phomacin A (CHEBI:66746) has role antineoplastic agent (CHEBI:35610) |
| phomacin A (CHEBI:66746) has role fungal metabolite (CHEBI:76946) |
| phomacin A (CHEBI:66746) is a cytochalasin (CHEBI:23528) |
| phomacin A (CHEBI:66746) is a macrolide antibiotic (CHEBI:25105) |
| phomacin A (CHEBI:66746) is a organic heterotricyclic compound (CHEBI:26979) |
| IUPAC Name |
|---|
| (3Z,5R,6S,7S,9E,10aS,13S,13aS,14S,16aR)-5,6-dihydroxy-7,9,12,13-tetramethyl-14-(2-methylpropyl)-6,7,8,10a,13,13a,14,15-octahydro-2H-oxacyclododecino[2,3-d]isoindole-2,16(5H)-dione |
| Citations |
|---|