EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H18O12 |
| Net Charge | 0 |
| Average Mass | 594.484 |
| Monoisotopic Mass | 594.07983 |
| SMILES | O=C1C=C(/C=C/c2ccc(O)c(O)c2)OC12C(c1cc3oc(=O)c4cc(O)c(O)cc4c3c(=O)o1)=Cc1cc(O)c(O)cc12 |
| InChI | InChI=1S/C32H18O12/c33-20-4-2-13(5-21(20)34)1-3-15-8-28(39)32(44-15)18-11-25(38)22(35)7-14(18)6-19(32)26-12-27-29(31(41)42-26)16-9-23(36)24(37)10-17(16)30(40)43-27/h1-12,33-38H/b3-1+ |
| InChIKey | FNYDGJUOSXPBRL-HNQUOIGGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phellinus igniarius (ncbitaxon:40472) | - | PubMed (15844878) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phelligridin G (CHEBI:66745) has role fungal metabolite (CHEBI:76946) |
| phelligridin G (CHEBI:66745) is a organic heterotricyclic compound (CHEBI:26979) |
| phelligridin G (CHEBI:66745) is a oxaspiro compound (CHEBI:37948) |
| phelligridin G (CHEBI:66745) is a polyphenol (CHEBI:26195) |
| phelligridin G (CHEBI:66745) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| 3-{5-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-5',6'-dihydroxy-3-oxo-3H-spiro[furan-2,1'-inden]-2'-yl}-8,9-dihydroxy-1H,6H-pyrano[4,3-c]isochromene-1,6-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10050771 | Reaxys |
| Citations |
|---|