EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C52H32O20 |
| Net Charge | 0 |
| Average Mass | 976.808 |
| Monoisotopic Mass | 976.14869 |
| SMILES | O=c1oc2cc(O)c1-c1cc(O)c(O)cc1/C=C/c1cc3c(c(=O)o1)[C@H](c1cc(O)c(c(=O)o1)-c1cc(O)c(O)cc1/C=C/c1cc4c(c(=O)o1)[C@H]2[C@@H](c1ccc(O)c(O)c1)O4)[C@@H](c1ccc(O)c(O)c1)O3 |
| InChI | InChI=1S/C52H32O20/c53-27-7-3-21(11-29(27)55)47-43-40-18-36(62)42(50(64)72-40)26-16-34(60)32(58)10-20(26)2-6-24-14-38-46(52(66)68-24)44(48(70-38)22-4-8-28(54)30(56)12-22)39-17-35(61)41(49(63)71-39)25-15-33(59)31(57)9-19(25)1-5-23-13-37(69-47)45(43)51(65)67-23/h1-18,43-44,47-48,53-62H/b5-1+,6-2+/t43-,44-,47+,48+/m0/s1 |
| InChIKey | CJFXDDUPHVDEGG-WBQDRZHYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phellinus igniarius (ncbitaxon:40472) | - | PubMed (16209522) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phelligridimer A (CHEBI:66744) has role antioxidant (CHEBI:22586) |
| phelligridimer A (CHEBI:66744) has role fungal metabolite (CHEBI:76946) |
| phelligridimer A (CHEBI:66744) is a furopyran (CHEBI:74927) |
| phelligridimer A (CHEBI:66744) is a macrocycle (CHEBI:51026) |
| phelligridimer A (CHEBI:66744) is a polyphenol (CHEBI:26195) |
| phelligridimer A (CHEBI:66744) is a δ-lactone (CHEBI:18946) |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10326878 | Reaxys |
| Citations |
|---|