EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H43NO6 |
| Net Charge | 0 |
| Average Mass | 477.642 |
| Monoisotopic Mass | 477.30904 |
| SMILES | CCC[C@H](O)C[C@@H]1CC[C@H](C)CCCCC(=O)N(C)[C@@H](Cc2ccc(OCCO)cc2)C(=O)O1 |
| InChI | InChI=1S/C27H43NO6/c1-4-7-22(30)19-24-13-10-20(2)8-5-6-9-26(31)28(3)25(27(32)34-24)18-21-11-14-23(15-12-21)33-17-16-29/h11-12,14-15,20,22,24-25,29-30H,4-10,13,16-19H2,1-3H3/t20-,22+,24+,25+/m1/s1 |
| InChIKey | SDBGPLZSWIQIOV-VQPAQMSKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (10724005) | Strain: PF1163 |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PF 1163A (CHEBI:66740) has role Penicillium metabolite (CHEBI:76964) |
| PF 1163A (CHEBI:66740) has role antifungal agent (CHEBI:35718) |
| PF 1163A (CHEBI:66740) is a aromatic ether (CHEBI:35618) |
| PF 1163A (CHEBI:66740) is a lactam (CHEBI:24995) |
| PF 1163A (CHEBI:66740) is a macrolide antibiotic (CHEBI:25105) |
| PF 1163A (CHEBI:66740) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (3S,10R,13S)-3-[4-(2-hydroxyethoxy)benzyl]-13-[(2S)-2-hydroxypentyl]-4,10-dimethyl-1-oxa-4-azacyclotridecane-2,5-dione |
| Synonym | Source |
|---|---|
| (−)-PF 1163A | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8523092 | Reaxys |
| Citations |
|---|