EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H16O6S |
| Net Charge | 0 |
| Average Mass | 312.343 |
| Monoisotopic Mass | 312.06676 |
| SMILES | CC(C)=CCc1cc(/C=C/C(=O)O)ccc1OS(=O)(=O)O |
| InChI | InChI=1S/C14H16O6S/c1-10(2)3-6-12-9-11(5-8-14(15)16)4-7-13(12)20-21(17,18)19/h3-5,7-9H,6H2,1-2H3,(H,15,16)(H,17,18,19)/b8-5+ |
| InChIKey | AVUZOEYGJPUQDM-VMPITWQZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Petasites formosanus (IPNI:237361-1) | leaf (BTO:0000713) | PubMed (15340211) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Petasiformin A (CHEBI:66738) has role metabolite (CHEBI:25212) |
| Petasiformin A (CHEBI:66738) is a cinnamic acids (CHEBI:23252) |
| Synonyms | Source |
|---|---|
| 3-[3-(3-Methyl-2-buten-1-yl)-4-(sulfooxy)phenyl]acrylic acid | ChEBI |
| 4-O-Sulfonyl-3-prenyl-p-coumaric acid | ChEBI |
| Citations |
|---|