EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H24O4 |
| Net Charge | 0 |
| Average Mass | 280.364 |
| Monoisotopic Mass | 280.16746 |
| SMILES | [H][C@@]12O[C@@]13C[C@H](C(C)(C)O)O[C@@]3([H])C/C(=C/C=C(C)C)[C@H]2O |
| InChI | InChI=1S/C16H24O4/c1-9(2)5-6-10-7-11-16(14(20-16)13(10)17)8-12(19-11)15(3,4)18/h5-6,11-14,17-18H,7-8H2,1-4H3/b10-6-/t11-,12+,13+,14-,16+/m0/s1 |
| InChIKey | FWSQMPDAXKALDF-MXRRJLFPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pestalotiopsis theae (ncbitaxon:218556) | - | PubMed (18303847) | Plant endophytic fungus |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pestalotheol C (CHEBI:66737) has role metabolite (CHEBI:25212) |
| Pestalotheol C (CHEBI:66737) is a oxacycle (CHEBI:38104) |
| Synonym | Source |
|---|---|
| (1aR,3R,4aS,6Z,7R,7aS)-3-(2-Hydroxy-2-propanyl)-6-(3-methyl-2-buten-1-ylidene)hexahydro-4aH-oxireno[d][1]benzofuran-7-ol | ChEBI |
| Citations |
|---|