EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H38O4 |
| Net Charge | 0 |
| Average Mass | 378.553 |
| Monoisotopic Mass | 378.27701 |
| SMILES | CCCCC/C=C\C/C=C\CCCCC/C=C/C(=O)CC(O)COC(C)=O |
| InChI | InChI=1S/C23H38O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22(25)19-23(26)20-27-21(2)24/h7-8,10-11,17-18,23,26H,3-6,9,12-16,19-20H2,1-2H3/b8-7-,11-10-,18-17+ |
| InChIKey | YLWJMUPPJKELEC-GQQAEKEGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Persea americana (ncbitaxon:3435) | fruit (BTO:0000486) | PubMed (10820058) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Persenone A (CHEBI:66735) has role metabolite (CHEBI:25212) |
| Persenone A (CHEBI:66735) is a long-chain fatty alcohol (CHEBI:17135) |
| Synonym | Source |
|---|---|
| (5E,12Z,15Z)-2-Hydroxy-4-oxo-5,12,15-henicosatrien-1-yl acetate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0036568 | HMDB |
| Citations |
|---|