EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H30O4 |
| Net Charge | 0 |
| Average Mass | 406.522 |
| Monoisotopic Mass | 406.21441 |
| SMILES | COc1cc(O)c(C(=O)[C@@H]2[C@H](CC=C(C)C)C(C)=CC[C@H]2c2ccccc2)c(O)c1 |
| InChI | InChI=1S/C26H30O4/c1-16(2)10-12-20-17(3)11-13-21(18-8-6-5-7-9-18)24(20)26(29)25-22(27)14-19(30-4)15-23(25)28/h5-11,14-15,20-21,24,27-28H,12-13H2,1-4H3/t20-,21+,24-/m1/s1 |
| InChIKey | LYDZCXVWCFJAKQ-ZFGGDYGUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Kaempferia pandurata (IPNI:797186-1) | rhizome (BTO:0001181) | PubMed (15930750) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Panduratin A (CHEBI:66725) has role metabolite (CHEBI:25212) |
| Panduratin A (CHEBI:66725) is a diarylheptanoid (CHEBI:78802) |
| Synonym | Source |
|---|---|
| (2,6-dihydroxy-4-methoxyphenyl)[(1R,2S,6R)-3-methyl-2-(3-methylbut-2-en-1-yl)-6-phenylcyclohex-3-en-1-yl]methanone | ChEBI |
| Citations |
|---|