EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16O5 |
| Net Charge | 0 |
| Average Mass | 312.321 |
| Monoisotopic Mass | 312.09977 |
| SMILES | CC1Oc2cc(O)c3c(=O)c4cccc(O)c4oc3c2C1(C)C |
| InChI | InChI=1S/C18H16O5/c1-8-18(2,3)14-12(22-8)7-11(20)13-15(21)9-5-4-6-10(19)16(9)23-17(13)14/h4-8,19-20H,1-3H3 |
| InChIKey | SPSZQWKBQUMDPB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Calophyllum pauciflorum (IPNI:427257-1) | stem (BTO:0001300) | DOI (10.1248/cpb.44.441) | Previous component: stem bark; |
| Garcinia vieillardii (IPNI:428302-1) | stem (BTO:0001300) | PubMed (17826924) | Previous component: stem bark; |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pancixanthone B (CHEBI:66724) has role plant metabolite (CHEBI:76924) |
| pancixanthone B (CHEBI:66724) is a organic heterotetracyclic compound (CHEBI:38163) |
| pancixanthone B (CHEBI:66724) is a polyphenol (CHEBI:26195) |
| pancixanthone B (CHEBI:66724) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| 5,10-dihydroxy-1,1,2-trimethyl-1,2-dihydro-6H-furo[2,3-c]xanthen-6-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7545909 | Reaxys |
| Citations |
|---|