EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C46H69N5O10 |
| Net Charge | 0 |
| Average Mass | 852.083 |
| Monoisotopic Mass | 851.50444 |
| SMILES | C#CCCC[C@@H](O)[C@@H](C)[C@@H]1C/C=C(\C)C(=O)O[C@H](CC(C)C)C(=O)N[C@@H](C)C(=O)N(C)[C@H](Cc2ccccc2)C(=O)N(C)CC(=O)N[C@@H]([C@H](C)CC)C(=O)N(C)[C@@H](C)C(=O)O1 |
| InChI | InChI=1S/C46H69N5O10/c1-13-15-17-22-36(52)31(7)37-24-23-30(6)45(58)61-38(25-28(3)4)41(54)47-32(8)42(55)51(12)35(26-34-20-18-16-19-21-34)43(56)49(10)27-39(53)48-40(29(5)14-2)44(57)50(11)33(9)46(59)60-37/h1,16,18-21,23,28-29,31-33,35-38,40,52H,14-15,17,22,24-27H2,2-12H3,(H,47,54)(H,48,53)/b30-23+/t29-,31-,32+,33+,35-,36-,37+,38-,40+/m1/s1 |
| InChIKey | RPWUMVNDBWYDLU-DRBNVQAHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lyngbya (ncbitaxon:28073) | - | PubMed (14695793) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| palau'amide (CHEBI:66721) has role antineoplastic agent (CHEBI:35610) |
| palau'amide (CHEBI:66721) has role metabolite (CHEBI:25212) |
| palau'amide (CHEBI:66721) is a cyclodepsipeptide (CHEBI:35213) |
| palau'amide (CHEBI:66721) is a macrocycle (CHEBI:51026) |
| IUPAC Name |
|---|
| (3S,6S,12R,15S,18R,21E,24S)-12-benzyl-6-sec-butyl-24-[(2R,3R)-3-hydroxyoct-7-yn-2-yl]-18-isobutyl-3,4,10,13,15,21-hexamethyl-1,19-dioxa-4,7,10,13,16-pentaazacyclotetracos-21-ene-2,5,8,11,14,17,20-heptone |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9834403 | Reaxys |
| Citations |
|---|