EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H28O11 |
| Net Charge | 0 |
| Average Mass | 480.466 |
| Monoisotopic Mass | 480.16316 |
| SMILES | [H][C@@]1(O[C@]23C[C@]4([H])[C@@]2(COC(=O)c2ccccc2)[C@]2([H])O[C@]4(O)C[C@]3(C)O2)O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C23H28O11/c1-20-9-22(29)13-7-23(20,32-18-16(27)15(26)14(25)12(8-24)31-18)21(13,19(33-20)34-22)10-30-17(28)11-5-3-2-4-6-11/h2-6,12-16,18-19,24-27,29H,7-10H2,1H3/t12-,13-,14+,15+,16-,18+,19+,20+,21+,22-,23+/m1/s1 |
| InChIKey | YKRGDOXKVOZESV-COKHGNMNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Paeonia emodi (ncbitaxon:40708) | root (BTO:0001188) | PubMed (12612406) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Paeonin B (CHEBI:66720) has role metabolite (CHEBI:25212) |
| Paeonin B (CHEBI:66720) is a terpene glycoside (CHEBI:61777) |
| Citations |
|---|