EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H24N2O3 |
| Net Charge | 0 |
| Average Mass | 256.346 |
| Monoisotopic Mass | 256.17869 |
| SMILES | CC(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C=O)C(C)C |
| InChI | InChI=1S/C13H24N2O3/c1-8(2)6-11(14-10(5)17)13(18)15-12(7-16)9(3)4/h7-9,11-12H,6H2,1-5H3,(H,14,17)(H,15,18)/t11-,12+/m0/s1 |
| InChIKey | FCSVBIFJBYWEQD-NWDGAFQWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Paecilomyces carneus (ncbitaxon:64635) | - | PubMed (12506985) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Paecilopeptin (CHEBI:66717) has role metabolite (CHEBI:25212) |
| Paecilopeptin (CHEBI:66717) is a N-acyl-amino acid (CHEBI:51569) |
| Synonyms | Source |
|---|---|
| (2S)-2-acetamido-4-methyl-N-[(2S)-3-methyl-1-oxobutan-2-yl]pentanamide | ChEBI |
| N2-Acetyl-N-[(2S)-3-methyl-1-oxo-2-butanyl]-L-leucinamide | ChEBI |
| Citations |
|---|