EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O3 |
| Net Charge | 0 |
| Average Mass | 322.489 |
| Monoisotopic Mass | 322.25079 |
| SMILES | [H][C@]12C[C@]1([H])[C@@](C)(CCC1OC1(C)C)CC[C@]1(C)O[C@@]1([H])CC[C@]2(C)O |
| InChI | InChI=1S/C20H34O3/c1-17(2)15(22-17)6-8-18(3)10-11-20(5)16(23-20)7-9-19(4,21)14-12-13(14)18/h13-16,21H,6-12H2,1-5H3/t13-,14-,15?,16-,18-,19-,20-/m0/s1 |
| InChIKey | MCWVOWAWZDPFLF-VONCVDJPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nephthea elongata (WORMS:288668) | - | PubMed (17541187) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pacificin L(rel) (CHEBI:66716) has role metabolite (CHEBI:25212) |
| Pacificin L(rel) (CHEBI:66716) is a tertiary alcohol (CHEBI:26878) |
| Synonym | Source |
|---|---|
| rel-(1S,2S,5S,7S,10S,11S)-10-[2-(3,3-Dimethyl-2-oxiranyl)ethyl]-2,7,10-trimethyl-6-oxatricyclo[9.1.0.05,7]dodecan-2-ol | ChEBI |
| Citations |
|---|