EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H36O3 |
| Net Charge | 0 |
| Average Mass | 348.527 |
| Monoisotopic Mass | 348.26645 |
| SMILES | [H][C@]12C[C@]1([H])[C@@](C)(CCC=C(C)C)CC/C(C)=C/[C@H](OC(C)=O)C[C@]2(C)O |
| InChI | InChI=1S/C22H36O3/c1-15(2)8-7-10-21(5)11-9-16(3)12-18(25-17(4)23)14-22(6,24)20-13-19(20)21/h8,12,18-20,24H,7,9-11,13-14H2,1-6H3/b16-12+/t18-,19-,20-,21-,22-/m0/s1 |
| InChIKey | LQNQQEXNXLBURL-WTDFRTEQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nephthea elongata (WORMS:288668) | - | PubMed (17541187) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pacificin K(rel) (CHEBI:66715) has role metabolite (CHEBI:25212) |
| Pacificin K(rel) (CHEBI:66715) is a tertiary alcohol (CHEBI:26878) |
| Synonym | Source |
|---|---|
| rel-(1S,2S,4R,9S,10S)-2-Hydroxy-2,6,9-trimethyl-9-(4-methyl-3-penten-1-yl)bicyclo[8.1.0]undec-5-en-4-ylacetate | ChEBI |
| Citations |
|---|