EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H30O9 |
| Net Charge | 0 |
| Average Mass | 486.517 |
| Monoisotopic Mass | 486.18898 |
| SMILES | CC(C)=CCc1c(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)ccc(C(=O)/C=C/c2ccc(O)cc2)c1O |
| InChI | InChI=1S/C26H30O9/c1-14(2)3-9-18-20(34-26-25(33)24(32)23(31)21(13-27)35-26)12-10-17(22(18)30)19(29)11-6-15-4-7-16(28)8-5-15/h3-8,10-12,21,23-28,30-33H,9,13H2,1-2H3/b11-6+/t21-,23-,24+,25-,26-/m1/s1 |
| InChIKey | HNRQFWQDRYQVNP-BAOGALEJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Maclura tinctoria (ncbitaxon:681456) | stem (BTO:0001300) | PubMed (12932124) | Previous component: stem bark; |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3'-(3-methyl-2-butenyl)-4'-O-β-D-glucopyranosyl-4,2'-dihydroxychalcone (CHEBI:66712) has functional parent trans-chalcone (CHEBI:48965) |
| 3'-(3-methyl-2-butenyl)-4'-O-β-D-glucopyranosyl-4,2'-dihydroxychalcone (CHEBI:66712) has role antioxidant (CHEBI:22586) |
| 3'-(3-methyl-2-butenyl)-4'-O-β-D-glucopyranosyl-4,2'-dihydroxychalcone (CHEBI:66712) has role metabolite (CHEBI:25212) |
| 3'-(3-methyl-2-butenyl)-4'-O-β-D-glucopyranosyl-4,2'-dihydroxychalcone (CHEBI:66712) is a chalcones (CHEBI:23086) |
| 3'-(3-methyl-2-butenyl)-4'-O-β-D-glucopyranosyl-4,2'-dihydroxychalcone (CHEBI:66712) is a monosaccharide derivative (CHEBI:63367) |
| 3'-(3-methyl-2-butenyl)-4'-O-β-D-glucopyranosyl-4,2'-dihydroxychalcone (CHEBI:66712) is a polyphenol (CHEBI:26195) |
| 3'-(3-methyl-2-butenyl)-4'-O-β-D-glucopyranosyl-4,2'-dihydroxychalcone (CHEBI:66712) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 3-hydroxy-4-[(2E)-3-(4-hydroxyphenyl)prop-2-enoyl]-2-(3-methylbut-2-en-1-yl)phenyl β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| (E)-1-[2-hydroxy-3-(3-methylbut-2-enyl)-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]-3-(4-hydroxyphenyl)prop-2-en-1-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9531324 | Reaxys |
| Citations |
|---|