EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H19NO4 |
| Net Charge | 0 |
| Average Mass | 253.298 |
| Monoisotopic Mass | 253.13141 |
| SMILES | COC(=O)c1ccc(N)cc1CC(O)C(C)(C)O |
| InChI | InChI=1S/C13H19NO4/c1-13(2,17)11(15)7-8-6-9(14)4-5-10(8)12(16)18-3/h4-6,11,15,17H,7,14H2,1-3H3 |
| InChIKey | GFEYQRHXVKZFIV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xylaria (ncbitaxon:37991) | - | PubMed (17978529) | Strain: BCC 9653 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl 4-amino-2-(2,3-dihydroxy-3-methylbutyl)benzoate (CHEBI:66710) has role metabolite (CHEBI:25212) |
| methyl 4-amino-2-(2,3-dihydroxy-3-methylbutyl)benzoate (CHEBI:66710) is a aromatic amine (CHEBI:33860) |
| methyl 4-amino-2-(2,3-dihydroxy-3-methylbutyl)benzoate (CHEBI:66710) is a benzoate ester (CHEBI:36054) |
| methyl 4-amino-2-(2,3-dihydroxy-3-methylbutyl)benzoate (CHEBI:66710) is a diol (CHEBI:23824) |
| methyl 4-amino-2-(2,3-dihydroxy-3-methylbutyl)benzoate (CHEBI:66710) is a primary amino compound (CHEBI:50994) |
| methyl 4-amino-2-(2,3-dihydroxy-3-methylbutyl)benzoate (CHEBI:66710) is a secondary alcohol (CHEBI:35681) |
| methyl 4-amino-2-(2,3-dihydroxy-3-methylbutyl)benzoate (CHEBI:66710) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| methyl 4-amino-2-(2,3-dihydroxy-3-methylbutyl)benzoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11246371 | Reaxys |
| Citations |
|---|