EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H23N3O4 |
| Net Charge | 0 |
| Average Mass | 393.443 |
| Monoisotopic Mass | 393.16886 |
| SMILES | [H][C@@]12CCCN1C(=O)C1=C[C@@]3(C(=O)Nc4cc(OC)ccc43)[C@H](C=C(C)C)N1C2=O |
| InChI | InChI=1S/C22H23N3O4/c1-12(2)9-18-22(14-7-6-13(29-3)10-15(14)23-21(22)28)11-17-19(26)24-8-4-5-16(24)20(27)25(17)18/h6-7,9-11,16,18H,4-5,8H2,1-3H3,(H,23,28)/t16-,18-,22-/m0/s1 |
| InChIKey | UHQKDPCPFNXIDU-ZJBJCVSYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus sydowii (ncbitaxon:75750) | - | PubMed (18505285) | Strain: PFW1-13 |
| Roles Classification |
|---|
| Biological Roles: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-methoxyspirotryprostatin B (CHEBI:66707) has role Aspergillus metabolite (CHEBI:76956) |
| 6-methoxyspirotryprostatin B (CHEBI:66707) has role antineoplastic agent (CHEBI:35610) |
| 6-methoxyspirotryprostatin B (CHEBI:66707) is a aromatic ether (CHEBI:35618) |
| 6-methoxyspirotryprostatin B (CHEBI:66707) is a azaspiro compound (CHEBI:35624) |
| 6-methoxyspirotryprostatin B (CHEBI:66707) is a indole alkaloid (CHEBI:38958) |
| 6-methoxyspirotryprostatin B (CHEBI:66707) is a indolones (CHEBI:24829) |
| IUPAC Name |
|---|
| (2S,3S,5aS)-6'-methoxy-3-(2-methylprop-1-en-1-yl)-5a,6,7,8-tetrahydro-5H,10H-spiro[dipyrrolo[1,2-a:1',2'-d]pyrazine-2,3'-indole]-2',5,10(1'H)-trione |
| Manual Xrefs | Databases |
|---|---|
| 23329453 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18842463 | Reaxys |
| Citations |
|---|