EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H24O5 |
| Net Charge | 0 |
| Average Mass | 380.440 |
| Monoisotopic Mass | 380.16237 |
| SMILES | CO/C(=C\C(=O)c1c(OC)cc2c(c1OC)C=CC(C)(C)O2)c1ccccc1 |
| InChI | InChI=1S/C23H24O5/c1-23(2)12-11-16-19(28-23)14-20(26-4)21(22(16)27-5)17(24)13-18(25-3)15-9-7-6-8-10-15/h6-14H,1-5H3/b18-13- |
| InChIKey | KLIBVTLWIJEYNK-AQTBWJFISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pongamia pinnata (ncbitaxon:56065) | stem (BTO:0001300) | PubMed (14510596) | Previous component: stem bark; |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-methoxypraecansone B (CHEBI:66706) has role metabolite (CHEBI:25212) |
| 7-methoxypraecansone B (CHEBI:66706) is a chalcones (CHEBI:23086) |
| 7-methoxypraecansone B (CHEBI:66706) is a enol ether (CHEBI:47985) |
| IUPAC Name |
|---|
| (2Z)-1-(5,7-dimethoxy-2,2-dimethyl-2H-chromen-6-yl)-3-methoxy-3-phenylprop-2-en-1-one |
| Synonym | Source |
|---|---|
| 7,2',6'-trimethoxy-6'',6''-dimethylpyrano-(3',4':2'',3'')-chalcone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMPK12120394 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5139778 | Reaxys |
| Citations |
|---|