EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10N2O2 |
| Net Charge | 0 |
| Average Mass | 250.257 |
| Monoisotopic Mass | 250.07423 |
| SMILES | COc1cnc2ccc(=O)n3c4ccccc4c1c23 |
| InChI | InChI=1S/C15H10N2O2/c1-19-12-8-16-10-6-7-13(18)17-11-5-3-2-4-9(11)14(12)15(10)17/h2-8H,1H3 |
| InChIKey | LEPXKGXTXIACRO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Leitneria floridana (ncbitaxon:83908) | aerial part (BTO:0001658) | PubMed (11141127) | |
| Ailanthus altissima (ncbitaxon:23810) | xylem (BTO:0001468) | DOI (10.1248/cpb.24.1532) | Previous component: wood; Dried woods |
| Roles Classification |
|---|
| Biological Roles: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-methoxycanthinone (CHEBI:66700) has functional parent canthin-6-one (CHEBI:3363) |
| 1-methoxycanthinone (CHEBI:66700) has role anti-HIV agent (CHEBI:64946) |
| 1-methoxycanthinone (CHEBI:66700) has role metabolite (CHEBI:25212) |
| 1-methoxycanthinone (CHEBI:66700) is a aromatic ether (CHEBI:35618) |
| 1-methoxycanthinone (CHEBI:66700) is a indole alkaloid (CHEBI:38958) |
| 1-methoxycanthinone (CHEBI:66700) is a organic heterotetracyclic compound (CHEBI:38163) |
| IUPAC Name |
|---|
| 1-methoxy-6H-indolo[3,2,1-de][1,5]naphthyridin-6-one |
| Synonym | Source |
|---|---|
| 1-methoxycanthin-6-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:668854 | Reaxys |
| Citations |
|---|