EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10N2O2 |
| Net Charge | 0 |
| Average Mass | 250.257 |
| Monoisotopic Mass | 250.07423 |
| SMILES | COc1cnc2ccc(=O)n3c4ccccc4c1c23 |
| InChI | InChI=1S/C15H10N2O2/c1-19-12-8-16-10-6-7-13(18)17-11-5-3-2-4-9(11)14(12)15(10)17/h2-8H,1H3 |
| InChIKey | LEPXKGXTXIACRO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ailanthus altissima (ncbitaxon:23810) | xylem (BTO:0001468) | DOI (10.1248/cpb.24.1532) | Previous component: wood; Dried woods |
| Leitneria floridana (ncbitaxon:83908) | aerial part (BTO:0001658) | PubMed (11141127) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-methoxycanthinone (CHEBI:66700) has functional parent canthin-6-one (CHEBI:3363) |
| 1-methoxycanthinone (CHEBI:66700) has role anti-HIV agent (CHEBI:64946) |
| 1-methoxycanthinone (CHEBI:66700) has role metabolite (CHEBI:25212) |
| 1-methoxycanthinone (CHEBI:66700) is a aromatic ether (CHEBI:35618) |
| 1-methoxycanthinone (CHEBI:66700) is a indole alkaloid (CHEBI:38958) |
| 1-methoxycanthinone (CHEBI:66700) is a organic heterotetracyclic compound (CHEBI:38163) |
| IUPAC Name |
|---|
| 1-methoxy-6H-indolo[3,2,1-de][1,5]naphthyridin-6-one |
| Synonym | Source |
|---|---|
| 1-methoxycanthin-6-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:668854 | Reaxys |
| Citations |
|---|