EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10N2O2 |
| Net Charge | 0 |
| Average Mass | 250.257 |
| Monoisotopic Mass | 250.07423 |
| SMILES | COc1ccc2c3ccnc4ccc(=O)n(c2c1)c43 |
| InChI | InChI=1S/C15H10N2O2/c1-19-9-2-3-10-11-6-7-16-12-4-5-14(18)17(15(11)12)13(10)8-9/h2-8H,1H3 |
| InChIKey | OWCRARVHWCCRAG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eurycoma longifolia (ncbitaxon:458531) | root (BTO:0001188) | PubMed (1800638) | |
| Simaba cuspidata (IPNI:236515-2) | bark (BTO:0001301) | DOI (10.1016/S0031-9422(00)81981-0) | |
| Simaba multiflora (IPNI:236532-2) | xylem (BTO:0001468) | DOI (10.1016/S0040-4039(00)86970-1) | Previous component: wood; |
| Roles Classification |
|---|
| Biological Roles: | antiplasmodial drug An antiparasitic drug which is effective against Apicomplexan parasites in the genus Plasmodium. The genus contains over 200 species and includes those responsible for malaria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antiplasmodial drug An antiparasitic drug which is effective against Apicomplexan parasites in the genus Plasmodium. The genus contains over 200 species and includes those responsible for malaria. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-methoxycanthin-6-one (CHEBI:66699) has functional parent canthin-6-one (CHEBI:3363) |
| 9-methoxycanthin-6-one (CHEBI:66699) has role antineoplastic agent (CHEBI:35610) |
| 9-methoxycanthin-6-one (CHEBI:66699) has role antiplasmodial drug (CHEBI:64915) |
| 9-methoxycanthin-6-one (CHEBI:66699) has role metabolite (CHEBI:25212) |
| 9-methoxycanthin-6-one (CHEBI:66699) is a aromatic ether (CHEBI:35618) |
| 9-methoxycanthin-6-one (CHEBI:66699) is a indole alkaloid (CHEBI:38958) |
| 9-methoxycanthin-6-one (CHEBI:66699) is a organic heterotetracyclic compound (CHEBI:38163) |
| IUPAC Name |
|---|
| 9-methoxy-6H-indolo[3,2,1-de][1,5]naphthyridin-6-one |
| Synonyms | Source |
|---|---|
| 13-methoxy-1,6-diazatetracyclo[7.6.1.0(5,16).0(10,15)]hexadeca-3,5(16),6,8,10,12,14-heptaen-2-one | ChEBI |
| 8-methoxycanthin-6-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4470310 | Reaxys |
| Citations |
|---|