EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H32O4 |
| Net Charge | 0 |
| Average Mass | 372.505 |
| Monoisotopic Mass | 372.23006 |
| SMILES | COc1cc(OC)c2c(c1O)C=C[C@](C)(CC[C@@]1(C)CCC=C(C)[C@H]1C)O2 |
| InChI | InChI=1S/C23H32O4/c1-15-8-7-10-22(3,16(15)2)12-13-23(4)11-9-17-20(24)18(25-5)14-19(26-6)21(17)27-23/h8-9,11,14,16,24H,7,10,12-13H2,1-6H3/t16-,22-,23-/m1/s1 |
| InChIKey | KDDVGLFIPJEMAU-ZGNKEGEESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Spongia (ncbitaxon:121489) | - | PubMed (18057748) | Strain: SS 1037 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| metachromin T (CHEBI:66696) has role antineoplastic agent (CHEBI:35610) |
| metachromin T (CHEBI:66696) has role metabolite (CHEBI:25212) |
| metachromin T (CHEBI:66696) is a aromatic ether (CHEBI:35618) |
| metachromin T (CHEBI:66696) is a chromenes (CHEBI:23232) |
| metachromin T (CHEBI:66696) is a phenols (CHEBI:33853) |
| metachromin T (CHEBI:66696) is a sesquiterpenoid (CHEBI:26658) |
| IUPAC Name |
|---|
| (2SS)-6,8-dimethoxy-2-methyl-2-{2-[(1R,2S)-1,2,3-trimethylcyclohex-3-en-1-yl]ethyl}-2H-chromen-5-ol |
| Manual Xrefs | Databases |
|---|---|
| 23076806 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18556300 | Reaxys |
| Citations |
|---|