EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H39NO3 |
| Net Charge | 0 |
| Average Mass | 413.602 |
| Monoisotopic Mass | 413.29299 |
| SMILES | CC1=CCC[C@](C)(CC/C(C)=C/CC2=C(O)C(=O)C=C(NCCC(C)C)C2=O)[C@@H]1C |
| InChI | InChI=1S/C26H39NO3/c1-17(2)12-15-27-22-16-23(28)25(30)21(24(22)29)10-9-18(3)11-14-26(6)13-7-8-19(4)20(26)5/h8-9,16-17,20,27,30H,7,10-15H2,1-6H3/b18-9+/t20-,26-/m1/s1 |
| InChIKey | YBVKKXUZRPNHQO-JEJCENLRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Spongia (ncbitaxon:121489) | - | PubMed (18057748) | Strain: SS 1037 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| metachromin S (CHEBI:66695) has role antineoplastic agent (CHEBI:35610) |
| metachromin S (CHEBI:66695) has role metabolite (CHEBI:25212) |
| metachromin S (CHEBI:66695) is a monohydroxy-1,4-benzoquinones (CHEBI:67273) |
| metachromin S (CHEBI:66695) is a secondary amino compound (CHEBI:50995) |
| metachromin S (CHEBI:66695) is a sesquiterpenoid (CHEBI:26658) |
| IUPAC Name |
|---|
| 2-hydroxy-5-[(3-methylbutyl)amino]-3-{(2E)-3-methyl-5-[(1R,2S)-1,2,3-trimethylcyclohex-3-en-1-yl]pent-2-en-1-yl}cyclohexa-2,5-diene-1,4-dione |
| Manual Xrefs | Databases |
|---|---|
| 23076805 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18556301 | Reaxys |
| Citations |
|---|