EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H37NO3 |
| Net Charge | 0 |
| Average Mass | 351.531 |
| Monoisotopic Mass | 351.27734 |
| SMILES | CCC(C)CCCCCCCCCC/C(O)=C1\C(=O)C(C)N(C)C1=O |
| InChI | InChI=1S/C21H37NO3/c1-5-16(2)14-12-10-8-6-7-9-11-13-15-18(23)19-20(24)17(3)22(4)21(19)25/h16-17,23H,5-15H2,1-4H3/b19-18- |
| InChIKey | QDDWPSIPKTZOEU-HNENSFHCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Melophlus (ncbitaxon:283574) | - | PubMed (16755057) | |
| Melophlus sarasinorum (WORMS:169852) | - | PubMed (16755057) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| melophlin R (CHEBI:66693) has role antineoplastic agent (CHEBI:35610) |
| melophlin R (CHEBI:66693) has role metabolite (CHEBI:25212) |
| melophlin R (CHEBI:66693) is a enol (CHEBI:33823) |
| melophlin R (CHEBI:66693) is a pyrrolidin-2-ones (CHEBI:74223) |
| IUPAC Name |
|---|
| (3Z)-3-(1-hydroxy-12-methyltetradecylidene)-1,5-dimethylpyrrolidine-2,4-dione |
| Manual Xrefs | Databases |
|---|---|
| 24715723 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10382681 | Reaxys |
| Citations |
|---|