EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O5 |
| Net Charge | 0 |
| Average Mass | 348.439 |
| Monoisotopic Mass | 348.19367 |
| SMILES | [H][C@@]12CC[C@H]3C(=C)C(=O)[C@@]1([C@@H]3O)[C@@]1(O)C[C@]3([H])C(C)(C)CC[C@H](O)[C@@]23CO1 |
| InChI | InChI=1S/C20H28O5/c1-10-11-4-5-12-18-9-25-19(24,20(12,15(10)22)16(11)23)8-13(18)17(2,3)7-6-14(18)21/h11-14,16,21,23-24H,1,4-9H2,2-3H3/t11-,12-,13+,14-,16+,18-,19+,20-/m0/s1 |
| InChIKey | VPZCKRKZFRCZMX-FINWQXJNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Isodon megathyrsus (ncbitaxon:662919) | leaf (BTO:0000713) | PubMed (7528785) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| megathyrin A (CHEBI:66689) has parent hydride ent-kaurene (CHEBI:15415) |
| megathyrin A (CHEBI:66689) has role antineoplastic agent (CHEBI:35610) |
| megathyrin A (CHEBI:66689) has role metabolite (CHEBI:25212) |
| megathyrin A (CHEBI:66689) is a bridged compound (CHEBI:35990) |
| megathyrin A (CHEBI:66689) is a cyclic terpene ketone (CHEBI:36130) |
| megathyrin A (CHEBI:66689) is a lactol (CHEBI:38131) |
| IUPAC Name |
|---|
| (1α,5β,7β,8α,9β,10α,13α,14R)-1,7,14-trihydroxy-7,20-epoxykaur-16-en-15-one |
| Synonym | Source |
|---|---|
| 1α,7β,14β-trihydroxy-ent-7α,20-epoxy-kaur-16-en-15-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8238556 | Reaxys |
| Citations |
|---|