EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:66683 - epi-maslinic acid
| Formula | C30H48O4 |
| Net Charge | 0 |
| Average Mass | 472.710 |
| Monoisotopic Mass | 472.35526 |
| SMILES | [H][C@]12CC=C3[C@]4([H])CC(C)(C)CC[C@]4(C(=O)O)CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@H](O)[C@H](O)C[C@]21C |
| InChI | InChI=1S/C30H48O4/c1-25(2)12-14-30(24(33)34)15-13-28(6)18(19(30)16-25)8-9-22-27(5)17-20(31)23(32)26(3,4)21(27)10-11-29(22,28)7/h8,19-23,31-32H,9-17H2,1-7H3,(H,33,34)/t19-,20+,21-,22+,23+,27-,28+,29+,30-/m0/s1 |
| InChIKey | MDZKJHQSJHYOHJ-HFYZCPLSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Isodon japonicus (ncbitaxon:425908) | - | DOI (10.1039/C39730000707) | |
| Prunella vulgaris (ncbitaxon:39358) | |||
| leaf (BTO:0000713) | DOI (10.1016/0031-9422(86)88033-5) | ||
| stem (BTO:0001300) | DOI (10.1016/0031-9422(86)88033-5) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| epi-maslinic acid (CHEBI:66683) has parent hydride oleanane (CHEBI:36481) |
| epi-maslinic acid (CHEBI:66683) has role anti-inflammatory agent (CHEBI:67079) |
| epi-maslinic acid (CHEBI:66683) has role metabolite (CHEBI:25212) |
| epi-maslinic acid (CHEBI:66683) is a dihydroxy monocarboxylic acid (CHEBI:35972) |
| epi-maslinic acid (CHEBI:66683) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| (2α,3α)-2,3-dihydroxyolean-12-en-28-oic acid |
| Synonym | Source |
|---|---|
| 3-epimaslinic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2955659 | Reaxys |
| Citations |
|---|