EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:66682 - maslinic acid
| Formula | C30H48O4 |
| Net Charge | 0 |
| Average Mass | 472.710 |
| Monoisotopic Mass | 472.35526 |
| SMILES | [H][C@]12CC=C3[C@]4([H])CC(C)(C)CC[C@]4(C(=O)O)CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O)[C@H](O)C[C@]21C |
| InChI | InChI=1S/C30H48O4/c1-25(2)12-14-30(24(33)34)15-13-28(6)18(19(30)16-25)8-9-22-27(5)17-20(31)23(32)26(3,4)21(27)10-11-29(22,28)7/h8,19-23,31-32H,9-17H2,1-7H3,(H,33,34)/t19-,20+,21-,22+,23-,27-,28+,29+,30-/m0/s1 |
| InChIKey | MDZKJHQSJHYOHJ-LLICELPBSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eucalyptus viminalis (ncbitaxon:155764) | - | DOI (10.1007/BF00579992) | |
| Euptelea polyandra (ncbitaxon:13523) | bark (BTO:0001301) | DOI (10.1021/np50040a042) | |
| Geum japonicum (ncbitaxon:321607) | whole plant (BTO:0001461) | DOI (10.1021/np50028a032) | |
| Luehea divaricata (ncbitaxon:577011) | leaf (BTO:0000713) | Article (J BRAZ CHEM SOC, 2003, 14, 475) | |
| Salvia canariensis (ncbitaxon:49210) | aerial part (BTO:0001658) | PubMed (8759159) | |
| Olea europaea (ncbitaxon:4146) | fruit (BTO:0000486) | PubMed (12802735) | |
| Rosa laevigata (ncbitaxon:74652) | leaf (BTO:0000713) | PubMed (21384845) | 70% EtOH extract of dried leaves |
| Juglans sinensis (ncbitaxon:442437-1) | |||
| leaf (BTO:0000713) | PubMed (21309591) | 80% Methanolic extract of dried leaves and twigs | |
| twig (BTO:0001411) | PubMed (21309591) | 80% Methanolic extract of dried leaves and twigs | |
| Symplocos lancifolia (ncbitaxon:239704) | leaf (BTO:0000713) | PubMed (21288041) | Dried, powdered leaves extracted with boiling 80% methanol |
| Rubia yunnanensis (IPNI:765385-1) | root (BTO:0001188) | PubMed (21973054) | Methanolic extract of air dried powdered roots. |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| maslinic acid (CHEBI:66682) has parent hydride oleanane (CHEBI:36481) |
| maslinic acid (CHEBI:66682) has role anti-inflammatory agent (CHEBI:67079) |
| maslinic acid (CHEBI:66682) has role antineoplastic agent (CHEBI:35610) |
| maslinic acid (CHEBI:66682) has role antioxidant (CHEBI:22586) |
| maslinic acid (CHEBI:66682) has role plant metabolite (CHEBI:76924) |
| maslinic acid (CHEBI:66682) is a dihydroxy monocarboxylic acid (CHEBI:35972) |
| maslinic acid (CHEBI:66682) is a pentacyclic triterpenoid (CHEBI:25872) |
| Incoming Relation(s) |
| 2-O-caffeoyl maslinic acid (CHEBI:65547) has functional parent maslinic acid (CHEBI:66682) |
| 3-O-[β-D-glucopyranosyl]-28-O-[α-L-rhamnopyranosyl-(1→2)-β-D-glucopyranosyl]maslinic acid (CHEBI:68377) has functional parent maslinic acid (CHEBI:66682) |
| IUPAC Name |
|---|
| (2α,3β)-2,3-dihydroxyolean-12-en-28-oic acid |
| Synonyms | Source |
|---|---|
| Crategolic acid | ChemIDplus |
| Masilinic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| HMDB0002392 | HMDB |
| C16939 | KEGG COMPOUND |
| Maslinic_acid | Wikipedia |
| CN102579456 | Patent |
| CN102106861 | Patent |
| WO2011015692 | Patent |
| US2011105611 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2711878 | Reaxys |
| CAS:4373-41-5 | ChemIDplus |
| CAS:4373-41-5 | KEGG COMPOUND |
| Citations |
|---|