EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14O6 |
| Net Charge | 0 |
| Average Mass | 302.282 |
| Monoisotopic Mass | 302.07904 |
| SMILES | COc1cc(O)cc2c1C(=O)C(O)(Cc1ccc(O)cc1)O2 |
| InChI | InChI=1S/C16H14O6/c1-21-12-6-11(18)7-13-14(12)15(19)16(20,22-13)8-9-2-4-10(17)5-3-9/h2-7,17-18,20H,8H2,1H3 |
| InChIKey | IQTGAKWQIFFPQX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pterocarpus marsupium (IPNI:516505-1) | heartwood (PO:0004512) | DOI (10.1021/np50031a029) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. antilipemic drug A substance used to treat hyperlipidemia (an excess of lipids in the blood). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| marsupsin (CHEBI:66680) has role antilipemic drug (CHEBI:35679) |
| marsupsin (CHEBI:66680) has role hypoglycemic agent (CHEBI:35526) |
| marsupsin (CHEBI:66680) has role metabolite (CHEBI:25212) |
| marsupsin (CHEBI:66680) is a 1-benzofurans (CHEBI:38830) |
| marsupsin (CHEBI:66680) is a aromatic ether (CHEBI:35618) |
| marsupsin (CHEBI:66680) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 2,6-dihydroxy-2-(4-hydroxybenzyl)-4-methoxy-1-benzofuran-3(2H)-one |
| Synonyms | Source |
|---|---|
| (−)-2,6-dihydroxy-2-((4-hydroxyphenyl)methyl)-4-methoxy-3(2H)-benzofuranone | ChemIDplus |
| carpusin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5596528 | Reaxys |
| CAS:83889-80-9 | ChemIDplus |
| Citations |
|---|