EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H35N3O2 |
| Net Charge | 0 |
| Average Mass | 409.574 |
| Monoisotopic Mass | 409.27293 |
| SMILES | [H][C@@]12CCCCCCCc3ccc(n3)[C@@]1([H])[C@]1(N=C(c3cccn3)C[C@@H]1OC)O[C@@H](C)C2 |
| InChI | InChI=1S/C25H35N3O2/c1-17-15-18-9-6-4-3-5-7-10-19-12-13-21(27-19)24(18)25(30-17)23(29-2)16-22(28-25)20-11-8-14-26-20/h8,11-14,17-18,23-24,26-27H,3-7,9-10,15-16H2,1-2H3/t17-,18-,23-,24-,25+/m0/s1 |
| InChIKey | JPTGQNMDWMSVSF-XOLQFJJLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (19007176) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| marineosin B (CHEBI:66677) has role antineoplastic agent (CHEBI:35610) |
| marineosin B (CHEBI:66677) has role metabolite (CHEBI:25212) |
| marineosin B (CHEBI:66677) is a azaspiro compound (CHEBI:35624) |
| marineosin B (CHEBI:66677) is a ether (CHEBI:25698) |
| marineosin B (CHEBI:66677) is a macrocycle (CHEBI:51026) |
| marineosin B (CHEBI:66677) is a oxaspiro compound (CHEBI:37948) |
| marineosin B (CHEBI:66677) is a pyrroles (CHEBI:26455) |
| IUPAC Name |
|---|
| (1s,3S,3'S,4aS,15aS)-3'-methoxy-3-methyl-5'-(1H-pyrrol-2-yl)-3',4,4',4a,5,6,7,8,9,10,11,15a-dodecahydro-3H-spiro[12,15-epiminocyclotrideca[c]pyran-1,2'-pyrrole] |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19107684 | Reaxys |
| Citations |
|---|