EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H62O6 |
| Net Charge | 0 |
| Average Mass | 602.897 |
| Monoisotopic Mass | 602.45464 |
| SMILES | [H][C@@]12CCC3=C(CC[C@@]4(C)[C@@]3(C)CC[C@]4([H])[C@H](C)CCC(=C)C(C)C)[C@@]1(C)CC[C@]([H])(O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)C2(C)C |
| InChI | InChI=1S/C37H62O6/c1-21(2)22(3)10-11-23(4)24-14-18-37(9)26-12-13-28-34(5,6)29(16-17-35(28,7)25(26)15-19-36(24,37)8)43-33-32(41)31(40)30(39)27(20-38)42-33/h21,23-24,27-33,38-41H,3,10-20H2,1-2,4-9H3/t23-,24-,27-,28+,29+,30-,31+,32-,33+,35-,36-,37+/m1/s1 |
| InChIKey | PHOVCZWDVRTEJJ-SAMWAVPASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Silybum marianum (ncbitaxon:92921) | whole plant (BTO:0001461) | PubMed (16394559) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. EC 3.4.21.1 (chymotrypsin) inhibitor An EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of chymotrypsin (EC 3.4.21.1). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| marianoside B (CHEBI:66675) has role EC 3.4.21.1 (chymotrypsin) inhibitor (CHEBI:64943) |
| marianoside B (CHEBI:66675) has role plant metabolite (CHEBI:76924) |
| marianoside B (CHEBI:66675) is a tetracyclic triterpenoid (CHEBI:26893) |
| marianoside B (CHEBI:66675) is a triterpenoid saponin (CHEBI:61778) |
| marianoside B (CHEBI:66675) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| (3β)-24-methylidenelanost-8-en-3-yl β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| 24-methylene-lanoesta-8(9)-ene 3-O-β-D-glucopyranoside | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 9846362 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10321312 | Reaxys |
| Citations |
|---|