EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H50O3 |
| Net Charge | 0 |
| Average Mass | 470.738 |
| Monoisotopic Mass | 470.37600 |
| SMILES | [H][C@@]12CC(=O)C3=C(CC[C@@]4(C)[C@@]3(C)CC[C@]4([H])[C@H](C)CCC(=C)C(C)(C)O)[C@@]1(C)CC[C@H](O)C2(C)C |
| InChI | InChI=1S/C31H50O3/c1-19(10-11-20(2)28(5,6)34)21-12-17-31(9)26-22(13-16-30(21,31)8)29(7)15-14-25(33)27(3,4)24(29)18-23(26)32/h19,21,24-25,33-34H,2,10-18H2,1,3-9H3/t19-,21-,24+,25+,29-,30-,31+/m1/s1 |
| InChIKey | UVPFSDRHWXKUSF-FRIHGVDDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Silybum marianum (ncbitaxon:92921) | whole plant (BTO:0001461) | PubMed (16394559) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 3.4.21.1 (chymotrypsin) inhibitor An EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of chymotrypsin (EC 3.4.21.1). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| marianine (CHEBI:66673) has role EC 3.4.21.1 (chymotrypsin) inhibitor (CHEBI:64943) |
| marianine (CHEBI:66673) has role metabolite (CHEBI:25212) |
| marianine (CHEBI:66673) is a cyclic terpene ketone (CHEBI:36130) |
| marianine (CHEBI:66673) is a secondary alcohol (CHEBI:35681) |
| marianine (CHEBI:66673) is a tertiary alcohol (CHEBI:26878) |
| marianine (CHEBI:66673) is a tetracyclic triterpenoid (CHEBI:26893) |
| IUPAC Name |
|---|
| (3β)-3,25-dihydroxy-24-methylidenelanost-8-en-7-one |
| Synonym | Source |
|---|---|
| 24-methylene-7-oxo-lanosta-8(9)-3β,25-diol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10314331 | Reaxys |
| Citations |
|---|