EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30O6 |
| Net Charge | 0 |
| Average Mass | 390.476 |
| Monoisotopic Mass | 390.20424 |
| SMILES | [H][C@@]12[C@H](OC(C)=O)C[C@@H](C(=C)C=O)C[C@]13C(=O)OC[C@]21CCCC(C)(C)[C@@]1([H])[C@@H]3O |
| InChI | InChI=1S/C22H30O6/c1-12(10-23)14-8-15(28-13(2)24)16-21-7-5-6-20(3,4)17(21)18(25)22(16,9-14)19(26)27-11-21/h10,14-18,25H,1,5-9,11H2,2-4H3/t14-,15-,16+,17-,18+,21-,22+/m1/s1 |
| InChIKey | WAOUILKFOLDIAX-NJOKITKISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Isodon eriocalyx (IPNI:448573-1) | leaf (BTO:0000713) | PubMed (17020288) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| maoecrystal Z (CHEBI:66670) has role antineoplastic agent (CHEBI:35610) |
| maoecrystal Z (CHEBI:66670) has role metabolite (CHEBI:25212) |
| maoecrystal Z (CHEBI:66670) is a acetate ester (CHEBI:47622) |
| maoecrystal Z (CHEBI:66670) is a aldehyde (CHEBI:17478) |
| maoecrystal Z (CHEBI:66670) is a bridged compound (CHEBI:35990) |
| maoecrystal Z (CHEBI:66670) is a tetracyclic diterpenoid (CHEBI:52557) |
| maoecrystal Z (CHEBI:66670) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| (4aS,4bS,5R,7S,8aS,9S,9aR)-9-hydroxy-1,1-dimethyl-10-oxo-7-(3-oxoprop-1-en-2-yl)decahydro-4bH-4a,8a-(methanooxymethano)fluoren-5-yl acetate |
| Synonym | Source |
|---|---|
| 6β-hydroxy-11α-acetoxy-6,7:8,15-di-seco-7,20-olide-6,8-cyclo-ent-kaur-16-en-15-aldehyde | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10606514 | Reaxys |
| Citations |
|---|