EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H36O5 |
| Net Charge | 0 |
| Average Mass | 392.536 |
| Monoisotopic Mass | 392.25627 |
| SMILES | [H][C@]12CC[C@](C)(C=C)O[C@]1(C)C[C@H](OC(=O)CC(=O)O)[C@@]1([H])C(C)(C)CCC[C@]21C |
| InChI | InChI=1S/C23H36O5/c1-7-21(4)12-9-16-22(5)11-8-10-20(2,3)19(22)15(14-23(16,6)28-21)27-18(26)13-17(24)25/h7,15-16,19H,1,8-14H2,2-6H3,(H,24,25)/t15-,16+,19-,21-,22+,23+/m0/s1 |
| InChIKey | JZRGFUZJIZSKTF-ALFLKXBZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stemodia foliosa (IPNI:244396-2) | aerial part (BTO:0001658) | PubMed (18582112) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6α-malonyloxymanoyl oxide (CHEBI:66662) has role antibacterial agent (CHEBI:33282) |
| 6α-malonyloxymanoyl oxide (CHEBI:66662) has role metabolite (CHEBI:25212) |
| 6α-malonyloxymanoyl oxide (CHEBI:66662) is a cyclic ether (CHEBI:37407) |
| 6α-malonyloxymanoyl oxide (CHEBI:66662) is a labdane diterpenoid (CHEBI:36770) |
| 6α-malonyloxymanoyl oxide (CHEBI:66662) is a malonate ester (CHEBI:38083) |
| IUPAC Name |
|---|
| 3-{[(3R,4aR,6S,6aS,10aS,10bR)-3-ethenyl-3,4a,7,7,10a-pentamethyldodecahydro-1H-benzo[f]chromen-6-yl]oxy}-3-oxopropanoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19154464 | Reaxys |
| Citations |
|---|