EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H36O5 |
| Net Charge | 0 |
| Average Mass | 392.536 |
| Monoisotopic Mass | 392.25627 |
| SMILES | [H][C@]12CC[C@](C)(C=C)O[C@]1(C)C[C@H](OC(=O)CC(=O)O)[C@@]1([H])C(C)(C)CCC[C@]21C |
| InChI | InChI=1S/C23H36O5/c1-7-21(4)12-9-16-22(5)11-8-10-20(2,3)19(22)15(14-23(16,6)28-21)27-18(26)13-17(24)25/h7,15-16,19H,1,8-14H2,2-6H3,(H,24,25)/t15-,16+,19-,21-,22+,23+/m0/s1 |
| InChIKey | JZRGFUZJIZSKTF-ALFLKXBZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stemodia foliosa (IPNI:244396-2) | aerial part (BTO:0001658) | PubMed (18582112) |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6α-malonyloxymanoyl oxide (CHEBI:66662) has role antibacterial agent (CHEBI:33282) |
| 6α-malonyloxymanoyl oxide (CHEBI:66662) has role metabolite (CHEBI:25212) |
| 6α-malonyloxymanoyl oxide (CHEBI:66662) is a cyclic ether (CHEBI:37407) |
| 6α-malonyloxymanoyl oxide (CHEBI:66662) is a labdane diterpenoid (CHEBI:36770) |
| 6α-malonyloxymanoyl oxide (CHEBI:66662) is a malonate ester (CHEBI:38083) |
| IUPAC Name |
|---|
| 3-{[(3R,4aR,6S,6aS,10aS,10bR)-3-ethenyl-3,4a,7,7,10a-pentamethyldodecahydro-1H-benzo[f]chromen-6-yl]oxy}-3-oxopropanoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19154464 | Reaxys |
| Citations |
|---|