EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H24O5 |
| Net Charge | 0 |
| Average Mass | 320.385 |
| Monoisotopic Mass | 320.16237 |
| SMILES | COc1cc2c(c(OC)c1C(=O)C[C@@H](C)OC)C=CC(C)(C)O2 |
| InChI | InChI=1S/C18H24O5/c1-11(20-4)9-13(19)16-15(21-5)10-14-12(17(16)22-6)7-8-18(2,3)23-14/h7-8,10-11H,9H2,1-6H3/t11-/m1/s1 |
| InChIKey | DPGWUIJYAVUNMD-LLVKDONJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mallotus apelta (ncbitaxon:463319) | leaf (BTO:0000713) | PubMed (16276967) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-[1'-oxo-3'(R)-methoxy-butyl]-5,7-dimethoxy-2,2-dimethyl-2H-1-benzopyran (CHEBI:66661) has role antineoplastic agent (CHEBI:35610) |
| 6-[1'-oxo-3'(R)-methoxy-butyl]-5,7-dimethoxy-2,2-dimethyl-2H-1-benzopyran (CHEBI:66661) has role metabolite (CHEBI:25212) |
| 6-[1'-oxo-3'(R)-methoxy-butyl]-5,7-dimethoxy-2,2-dimethyl-2H-1-benzopyran (CHEBI:66661) is a aromatic ether (CHEBI:35618) |
| 6-[1'-oxo-3'(R)-methoxy-butyl]-5,7-dimethoxy-2,2-dimethyl-2H-1-benzopyran (CHEBI:66661) is a aromatic ketone (CHEBI:76224) |
| 6-[1'-oxo-3'(R)-methoxy-butyl]-5,7-dimethoxy-2,2-dimethyl-2H-1-benzopyran (CHEBI:66661) is a chromenes (CHEBI:23232) |
| IUPAC Name |
|---|
| (3R)-1-(5,7-dimethoxy-2,2-dimethyl-2H-chromen-6-yl)-3-methoxybutan-1-one |
| Synonym | Source |
|---|---|
| Mallotus benzopyran 2 | ChEBI |
| Citations |
|---|