EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H38O3 |
| Net Charge | 0 |
| Average Mass | 410.598 |
| Monoisotopic Mass | 410.28210 |
| SMILES | [H][C@]12CC=C(C)[C@@H](Cc3cc(C(=O)O)ccc3O)[C@]1(C)CC[C@@]1([H])C(C)(C)CCC[C@]21C |
| InChI | InChI=1S/C27H38O3/c1-17-7-10-23-26(4,14-11-22-25(2,3)12-6-13-27(22,23)5)20(17)16-19-15-18(24(29)30)8-9-21(19)28/h7-9,15,20,22-23,28H,6,10-14,16H2,1-5H3,(H,29,30)/t20-,22+,23+,26+,27+/m1/s1 |
| InChIKey | VIOMEESUKISOEL-XDEZJFBHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acanthodendrilla (ncbitaxon:558782) | - | PubMed (15620270) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | protein kinase inhibitor An EC 2.7.* (P-containing group transferase) inhibitor that interferes with the action of protein kinases. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-makassaric acid (CHEBI:66654) has role metabolite (CHEBI:25212) |
| (+)-makassaric acid (CHEBI:66654) has role protein kinase inhibitor (CHEBI:37699) |
| (+)-makassaric acid (CHEBI:66654) is a carbotricyclic compound (CHEBI:38032) |
| (+)-makassaric acid (CHEBI:66654) is a meroterpenoid (CHEBI:64419) |
| (+)-makassaric acid (CHEBI:66654) is a monohydroxybenzoic acid (CHEBI:25389) |
| IUPAC Name |
|---|
| 3-{[(14β)-8,13-dimethylpodocarp-12-en-14-yl]methyl}-4-hydroxybenzoic acid |
| Synonym | Source |
|---|---|
| 4-hydroxy-3-{[(1R,4aR,4bS,8aS,10aS)-2,4b,8,8,10a-pentamethyl-1,4,4a,4b,5,6,7,8,8a,9,10,10a-dodecahydrophenanthren-1-yl]methyl}benzoic acid | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11308967 | Reaxys |
| Citations |
|---|