EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H24O6 |
| Net Charge | 0 |
| Average Mass | 396.439 |
| Monoisotopic Mass | 396.15729 |
| SMILES | C=CC(C)(C)c1c(O)c(CC=C(C)C)c2oc3c(O)c(O)ccc3c(=O)c2c1O |
| InChI | InChI=1S/C23H24O6/c1-6-23(4,5)16-18(26)13(8-7-11(2)3)21-15(20(16)28)17(25)12-9-10-14(24)19(27)22(12)29-21/h6-7,9-10,24,26-28H,1,8H2,2-5H3 |
| InChIKey | INSDJDFCZJWKAI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Maclura tinctoria (ncbitaxon:681456) | - | PubMed (11087602) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| macluraxanthone C (CHEBI:66650) has role anti-HIV agent (CHEBI:64946) |
| macluraxanthone C (CHEBI:66650) has role antineoplastic agent (CHEBI:35610) |
| macluraxanthone C (CHEBI:66650) has role metabolite (CHEBI:25212) |
| macluraxanthone C (CHEBI:66650) is a phenols (CHEBI:33853) |
| macluraxanthone C (CHEBI:66650) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| 1,3,5,6-tetrahydroxy-2-(2-methylbut-3-en-2-yl)-4-(3-methylbut-2-en-1-yl)-9H-xanthen-9-one |
| Synonym | Source |
|---|---|
| 2-(1,1-dimethyl-allyl)-1,3,5,6-tetrahydroxy-4-(3-methyl-but-2-enyl)-xanthen-9-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8735066 | Reaxys |
| Citations |
|---|