EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H34O7 |
| Net Charge | 0 |
| Average Mass | 506.595 |
| Monoisotopic Mass | 506.23045 |
| SMILES | CC(C)=CCC/C(C)=C/Cc1c(-c2oc3cc(O)cc(O)c3c(=O)c2O)cc(CC=C(C)C)c(O)c1O |
| InChI | InChI=1S/C30H34O7/c1-16(2)7-6-8-18(5)10-12-21-22(13-19(11-9-17(3)4)26(33)27(21)34)30-29(36)28(35)25-23(32)14-20(31)15-24(25)37-30/h7,9-10,13-15,31-34,36H,6,8,11-12H2,1-5H3/b18-10+ |
| InChIKey | OAZFFUNCFJOTIQ-VCHYOVAHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Macaranga sampsonii (ncbitaxon:524430) | leaf (BTO:0000713) | PubMed (19420781) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| macaranone A (CHEBI:66648) has role antineoplastic agent (CHEBI:35610) |
| macaranone A (CHEBI:66648) has role metabolite (CHEBI:25212) |
| macaranone A (CHEBI:66648) is a flavonols (CHEBI:28802) |
| macaranone A (CHEBI:66648) is a pentahydroxyflavone (CHEBI:25883) |
| IUPAC Name |
|---|
| 2-{2-[(2E)-3,7-dimethylocta-2,6-dien-1-yl]-3,4-dihydroxy-5-(3-methylbut-2-en-1-yl)phenyl}-3,5,7-trihydroxy-4H-chromen-4-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19726973 | Reaxys |
| Citations |
|---|