EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H36O6 |
| Net Charge | 0 |
| Average Mass | 492.612 |
| Monoisotopic Mass | 492.25119 |
| SMILES | CC(C)=CCC[C@]1(C)CCc2c([C@@H]3CC(=O)c4c(cc(O)c(CC=C(C)C)c4O)O3)ccc(O)c2O1 |
| InChI | InChI=1S/C30H36O6/c1-17(2)7-6-13-30(5)14-12-20-19(10-11-22(31)29(20)36-30)25-16-24(33)27-26(35-25)15-23(32)21(28(27)34)9-8-18(3)4/h7-8,10-11,15,25,31-32,34H,6,9,12-14,16H2,1-5H3/t25-,30+/m0/s1 |
| InChIKey | YDKQMGVESZZFGP-SETSBSEESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Macaranga tanarius (ncbitaxon:109849) | leaf (BTO:0000713) | PubMed (18844422) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| macaflavanone G (CHEBI:66647) has role antineoplastic agent (CHEBI:35610) |
| macaflavanone G (CHEBI:66647) has role metabolite (CHEBI:25212) |
| macaflavanone G (CHEBI:66647) is a 4'-hydroxyflavanones (CHEBI:140331) |
| macaflavanone G (CHEBI:66647) is a trihydroxyflavanone (CHEBI:38739) |
| IUPAC Name |
|---|
| (2S,2'R)-5,7,8'-trihydroxy-2'-methyl-6-(3-methylbut-2-en-1-yl)-2'-(4-methylpent-3-en-1-yl)-2,3,3',4'-tetrahydro-2'H,4H-2,5'-bichromen-4-one |
| Synonym | Source |
|---|---|
| (2S)-5,7-dihydroxy-2-[(2R)-8-hydroxy-2-methyl-2-(4-methylpent-3-enyl)-3,4-dihydrochromen-5-yl]-6-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19334086 | Reaxys |
| Citations |
|---|