EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20O6 |
| Net Charge | 0 |
| Average Mass | 368.385 |
| Monoisotopic Mass | 368.12599 |
| SMILES | [H][C@@]12COc3cc(O)c4c(c3[C@]1([H])Oc1cc3c(cc12)OCO3)CCC(C)(C)O4 |
| InChI | InChI=1S/C21H20O6/c1-21(2)4-3-10-18-17(6-13(22)19(10)27-21)23-8-12-11-5-15-16(25-9-24-15)7-14(11)26-20(12)18/h5-7,12,20,22H,3-4,8-9H2,1-2H3/t12-,20+/m0/s1 |
| InChIKey | XVIZOEGEWDVLRY-FKIZINRSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Maackia amurensis (ncbitaxon:37501) | stem (BTO:0001300) | PubMed (19252325) | Previous component: stem bark; |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| maackiapterocarpan A (CHEBI:66645) has role antineoplastic agent (CHEBI:35610) |
| maackiapterocarpan A (CHEBI:66645) has role plant metabolite (CHEBI:76924) |
| maackiapterocarpan A (CHEBI:66645) is a organic heterohexacyclic compound (CHEBI:51914) |
| maackiapterocarpan A (CHEBI:66645) is a phenols (CHEBI:33853) |
| maackiapterocarpan A (CHEBI:66645) is a pterocarpans (CHEBI:26377) |
| IUPAC Name |
|---|
| (8aR,14aR)-3,3-dimethyl-1,2,3,8,8a,14a-hexahydro[1,3]dioxolo[5,6][1]benzofuro[3,2-c]pyrano[3,2-f]chromen-5-ol |
| Synonym | Source |
|---|---|
| 3-hydroxy-8,9-methylenedioxy-[2',2'-dimethyl-3',4'-dihydropyrano-(5',6' : 1,2)][6aR,11aR]-pterocarpan | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CN101434592 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19598945 | Reaxys |
| Citations |
|---|